C23H26N6O3 — CID 139922777
3-methyl-2-[[prop-2-enyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamoyl]amino]butanoic acid (PubChem CID 139922777) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-methyl-2-[[prop-2-enyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamoyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[prop-2-enyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139922777 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-methyl-2-[[prop-2-enyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamoyl]amino]butanoic acid |
| SMILES | C=CCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C23H26N6O3/c1-4-13-29(23(32)24-20(15(2)3)22(30)31)14-16-9-11-17(12-10-16)18-7-5-6-8-19(18)21-25-27-28-26-21/h4-12,15,20H,1,13-14H2,2-3H3,(H,24,32)(H,30,31)(H,25,26,27,28) |
| InChIKey | UWNMXZKMLOXPTH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|