C6H8KO11P — CID 139923727
potassium 3,5-dihydroxy-5-oxo-3-phosphonoperoxycarbonylpentanoate (PubChem CID 139923727) has the molecular formula C6H8KO11P and a molecular weight of 326.19 g/mol. Its IUPAC name is potassium 3,5-dihydroxy-5-oxo-3-phosphonoperoxycarbonylpentanoate.
| Compound Name | potassium 3,5-dihydroxy-5-oxo-3-phosphonoperoxycarbonylpentanoate |
|---|---|
| PubChem CID | 139923727 |
| Molecular Formula | C6H8KO11P |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | potassium 3,5-dihydroxy-5-oxo-3-phosphonoperoxycarbonylpentanoate |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)OOP(=O)(O)O.[K+] |
| InChI | InChI=1S/C6H9O11P.K/c7-3(8)1-6(12,2-4(9)10)5(11)16-17-18(13,14)15;/h12H,1-2H2,(H,7,8)(H,9,10)(H2,13,14,15);/q;+1/p-1 |
| InChIKey | KTFGJKBSRTZSSD-UHFFFAOYSA-M |
| XLogP | -6.10 |
| TPSA | 190.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | -6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|