C17H17N3OS — CID 139929672
2-(imidazol-1-ylmethyl)-1-(4-phenyl-1,3-thiazol-2-yl)butan-1-one (PubChem CID 139929672) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(imidazol-1-ylmethyl)-1-(4-phenyl-1,3-thiazol-2-yl)butan-1-one.
| Compound Name | 2-(imidazol-1-ylmethyl)-1-(4-phenyl-1,3-thiazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 139929672 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(imidazol-1-ylmethyl)-1-(4-phenyl-1,3-thiazol-2-yl)butan-1-one |
| SMILES | CCC(Cn1ccnc1)C(=O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H17N3OS/c1-2-13(10-20-9-8-18-12-20)16(21)17-19-15(11-22-17)14-6-4-3-5-7-14/h3-9,11-13H,2,10H2,1H3 |
| InChIKey | VQWHYRFSFILQEN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |