C18H16Cl2O2 — CID 139930191
1,8-dichloro-9,10-diethoxyanthracene (PubChem CID 139930191) has the molecular formula C18H16Cl2O2 and a molecular weight of 335.23 g/mol. Its IUPAC name is 1,8-dichloro-9,10-diethoxyanthracene.
| Compound Name | 1,8-dichloro-9,10-diethoxyanthracene |
|---|---|
| PubChem CID | 139930191 |
| Molecular Formula | C18H16Cl2O2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1,8-dichloro-9,10-diethoxyanthracene |
| SMILES | CCOc1c2cccc(Cl)c2c(OCC)c2c(Cl)cccc12 |
| InChI | InChI=1S/C18H16Cl2O2/c1-3-21-17-11-7-5-9-13(19)15(11)18(22-4-2)16-12(17)8-6-10-14(16)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | NNUKMVFOTUJDEX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|