C24H28Cl2O2 — CID 139930127
1,5-dichloro-9,10-di(pentan-2-yloxy)anthracene (PubChem CID 139930127) has the molecular formula C24H28Cl2O2 and a molecular weight of 419.39 g/mol. Its IUPAC name is 1,5-dichloro-9,10-di(pentan-2-yloxy)anthracene.
| Compound Name | 1,5-dichloro-9,10-di(pentan-2-yloxy)anthracene |
|---|---|
| PubChem CID | 139930127 |
| Molecular Formula | C24H28Cl2O2 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1,5-dichloro-9,10-di(pentan-2-yloxy)anthracene |
| SMILES | CCCC(C)Oc1c2cccc(Cl)c2c(OC(C)CCC)c2cccc(Cl)c12 |
| InChI | InChI=1S/C24H28Cl2O2/c1-5-9-15(3)27-23-17-11-7-14-20(26)22(17)24(28-16(4)10-6-2)18-12-8-13-19(25)21(18)23/h7-8,11-16H,5-6,9-10H2,1-4H3 |
| InChIKey | ZNBROJKKMPCFOO-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|