C17H12N4S — CID 139932445
3-phenyl-2-pyridin-4-ylsulfanylimidazo[4,5-b]pyridine (PubChem CID 139932445) has the molecular formula C17H12N4S and a molecular weight of 304.38 g/mol. Its IUPAC name is 3-phenyl-2-pyridin-4-ylsulfanylimidazo[4,5-b]pyridine.
| Compound Name | 3-phenyl-2-pyridin-4-ylsulfanylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139932445 |
| Molecular Formula | C17H12N4S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-phenyl-2-pyridin-4-ylsulfanylimidazo[4,5-b]pyridine |
| SMILES | c1ccc(-n2c(Sc3ccncc3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C17H12N4S/c1-2-5-13(6-3-1)21-16-15(7-4-10-19-16)20-17(21)22-14-8-11-18-12-9-14/h1-12H |
| InChIKey | YWIPDHRDDKOEPO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |