C18H23N3 — CID 139933372
1-N,2-N-dibenzylpyrrolidine-1,2-diamine (PubChem CID 139933372) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-N,2-N-dibenzylpyrrolidine-1,2-diamine.
| Compound Name | 1-N,2-N-dibenzylpyrrolidine-1,2-diamine |
|---|---|
| PubChem CID | 139933372 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-N,2-N-dibenzylpyrrolidine-1,2-diamine |
| SMILES | c1ccc(CNC2CCCN2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H23N3/c1-3-8-16(9-4-1)14-19-18-12-7-13-21(18)20-15-17-10-5-2-6-11-17/h1-6,8-11,18-20H,7,12-15H2 |
| InChIKey | LLHYJHVMKVFRRO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |