C18H20N4O2S2 — CID 139934869
5-amino-N-butyl-4-(3-hydroxyphenyl)-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 139934869) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 5-amino-N-butyl-4-(3-hydroxyphenyl)-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-amino-N-butyl-4-(3-hydroxyphenyl)-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 139934869 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 5-amino-N-butyl-4-(3-hydroxyphenyl)-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCCCNC(=O)c1sc2nc(SC)nc(-c3cccc(O)c3)c2c1N |
| InChI | InChI=1S/C18H20N4O2S2/c1-3-4-8-20-16(24)15-13(19)12-14(10-6-5-7-11(23)9-10)21-18(25-2)22-17(12)26-15/h5-7,9,23H,3-4,8,19H2,1-2H3,(H,20,24) |
| InChIKey | JFGPQFKSKUXVJC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|