C20H21N3O5S2 — CID 22597653
ethyl 4-[3-(2-acetyloxyethoxy)phenyl]-5-amino-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 22597653) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 4-[3-(2-acetyloxyethoxy)phenyl]-5-amino-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-[3-(2-acetyloxyethoxy)phenyl]-5-amino-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 22597653 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | ethyl 4-[3-(2-acetyloxyethoxy)phenyl]-5-amino-2-methylsulfanylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(SC)nc(-c3cccc(OCCOC(C)=O)c3)c2c1N |
| InChI | InChI=1S/C20H21N3O5S2/c1-4-26-19(25)17-15(21)14-16(22-20(29-3)23-18(14)30-17)12-6-5-7-13(10-12)28-9-8-27-11(2)24/h5-7,10H,4,8-9,21H2,1-3H3 |
| InChIKey | VZNUNGLFSZPKAQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|