C15H14F4N2O3 — CID 139934928
ethyl 1-(2-fluoroethyl)-3-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylate (PubChem CID 139934928) has the molecular formula C15H14F4N2O3 and a molecular weight of 346.28 g/mol. Its IUPAC name is ethyl 1-(2-fluoroethyl)-3-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-fluoroethyl)-3-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139934928 |
| Molecular Formula | C15H14F4N2O3 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | ethyl 1-(2-fluoroethyl)-3-[3-(trifluoromethyl)phenoxy]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCF)nc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F4N2O3/c1-2-23-14(22)12-9-21(7-6-16)20-13(12)24-11-5-3-4-10(8-11)15(17,18)19/h3-5,8-9H,2,6-7H2,1H3 |
| InChIKey | QDKQMAFEIZVSGQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |