C15H16F3N3O3 — CID 139934929
ethyl 3-[4-amino-3-(trifluoromethyl)phenoxy]-1-ethylpyrazole-4-carboxylate (PubChem CID 139934929) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is ethyl 3-[4-amino-3-(trifluoromethyl)phenoxy]-1-ethylpyrazole-4-carboxylate.
| Compound Name | ethyl 3-[4-amino-3-(trifluoromethyl)phenoxy]-1-ethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139934929 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 3-[4-amino-3-(trifluoromethyl)phenoxy]-1-ethylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)nc1Oc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3N3O3/c1-3-21-8-10(14(22)23-4-2)13(20-21)24-9-5-6-12(19)11(7-9)15(16,17)18/h5-8H,3-4,19H2,1-2H3 |
| InChIKey | JAGPFIWJPJZSPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|