C15H15F3N2O3S — CID 15104324
ethyl 4-[4-amino-3-(trifluoromethyl)phenoxy]-2-ethyl-1,3-thiazole-5-carboxylate (PubChem CID 15104324) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is ethyl 4-[4-amino-3-(trifluoromethyl)phenoxy]-2-ethyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-[4-amino-3-(trifluoromethyl)phenoxy]-2-ethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 15104324 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | ethyl 4-[4-amino-3-(trifluoromethyl)phenoxy]-2-ethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(CC)nc1Oc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-3-11-20-13(12(24-11)14(21)22-4-2)23-8-5-6-10(19)9(7-8)15(16,17)18/h5-7H,3-4,19H2,1-2H3 |
| InChIKey | KNAPRRVYDXECFM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|