C25H24FN3 — CID 139935933
(8aS)-2-ethyl-7-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,5,6,8a-tetrahydroindolizine (PubChem CID 139935933) has the molecular formula C25H24FN3 and a molecular weight of 385.49 g/mol. Its IUPAC name is (8aS)-2-ethyl-7-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,5,6,8a-tetrahydroindolizine.
| Compound Name | (8aS)-2-ethyl-7-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,5,6,8a-tetrahydroindolizine |
|---|---|
| PubChem CID | 139935933 |
| Molecular Formula | C25H24FN3 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (8aS)-2-ethyl-7-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,5,6,8a-tetrahydroindolizine |
| SMILES | CCC1=C[C@@H]2C=C(c3c[nH]c(-c4ccc(F)cc4)c3-c3ccncc3)CCN2C1 |
| InChI | InChI=1S/C25H24FN3/c1-2-17-13-22-14-20(9-12-29(22)16-17)23-15-28-25(19-3-5-21(26)6-4-19)24(23)18-7-10-27-11-8-18/h3-8,10-11,13-15,22,28H,2,9,12,16H2,1H3/t22-/m1/s1 |
| InChIKey | KYDHCCMEAGXLCP-JOCHJYFZSA-N |
| XLogP | 5.69 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|