C23H21N3 — CID 10132000
7-(5-phenyl-4-pyridin-4-yl-1H-pyrrol-3-yl)-3,5,6,8a-tetrahydroindolizine (PubChem CID 10132000) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 7-(5-phenyl-4-pyridin-4-yl-1H-pyrrol-3-yl)-3,5,6,8a-tetrahydroindolizine.
| Compound Name | 7-(5-phenyl-4-pyridin-4-yl-1H-pyrrol-3-yl)-3,5,6,8a-tetrahydroindolizine |
|---|---|
| PubChem CID | 10132000 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 7-(5-phenyl-4-pyridin-4-yl-1H-pyrrol-3-yl)-3,5,6,8a-tetrahydroindolizine |
| SMILES | C1=CC2C=C(c3c[nH]c(-c4ccccc4)c3-c3ccncc3)CCN2C1 |
| InChI | InChI=1S/C23H21N3/c1-2-5-18(6-3-1)23-22(17-8-11-24-12-9-17)21(16-25-23)19-10-14-26-13-4-7-20(26)15-19/h1-9,11-12,15-16,20,25H,10,13-14H2 |
| InChIKey | DDPIKSIDXCPWCN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|