C31H29FN4O3S — CID 174509412
4-[2-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethenyl]-N-prop-2-enoxybenzenesulfonamide (PubChem CID 174509412) has the molecular formula C31H29FN4O3S and a molecular weight of 556.66 g/mol. Its IUPAC name is 4-[2-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethenyl]-N-prop-2-enoxybenzenesulfonamide.
| Compound Name | 4-[2-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethenyl]-N-prop-2-enoxybenzenesulfonamide |
|---|---|
| PubChem CID | 174509412 |
| Molecular Formula | C31H29FN4O3S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 4-[2-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethenyl]-N-prop-2-enoxybenzenesulfonamide |
| SMILES | C=CCONS(=O)(=O)c1ccc(C=CN2CC=C(c3c[nH]c(-c4ccc(F)cc4)c3-c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C31H29FN4O3S/c1-2-21-39-35-40(37,38)28-9-3-23(4-10-28)13-18-36-19-14-24(15-20-36)29-22-34-31(26-5-7-27(32)8-6-26)30(29)25-11-16-33-17-12-25/h2-14,16-18,22,34-35H,1,15,19-21H2 |
| InChIKey | NOTRKSCOSZLIED-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|