C25H29F2NO3 — CID 139936490
methyl 8-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-8-oxooctanoate (PubChem CID 139936490) has the molecular formula C25H29F2NO3 and a molecular weight of 429.51 g/mol. Its IUPAC name is methyl 8-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-8-oxooctanoate.
| Compound Name | methyl 8-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-8-oxooctanoate |
|---|---|
| PubChem CID | 139936490 |
| Molecular Formula | C25H29F2NO3 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | methyl 8-[8-fluoro-5-(4-fluorophenyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)N1CCCC(c2ccc(F)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C25H29F2NO3/c1-31-25(30)9-5-3-2-4-8-24(29)28-16-6-7-21(18-10-12-19(26)13-11-18)22-15-14-20(27)17-23(22)28/h10-15,17,21H,2-9,16H2,1H3 |
| InChIKey | CPQSLGZRXUHGCN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|