C30H31N5O7S2 — CID 139936938
[[2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]acetyl]-[(4-methanehydrazonoylphenyl)methyl]amino] 4-methylbenzenesulfonate (PubChem CID 139936938) has the molecular formula C30H31N5O7S2 and a molecular weight of 637.74 g/mol. Its IUPAC name is [[2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]acetyl]-[(4-methanehydrazonoylphenyl)methyl]amino] 4-methylbenzenesulfonate.
| Compound Name | [[2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]acetyl]-[(4-methanehydrazonoylphenyl)methyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139936938 |
| Molecular Formula | C30H31N5O7S2 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | [[2-[3-(benzylsulfonylamino)-6-methyl-2-oxo-1-pyridinyl]acetyl]-[(4-methanehydrazonoylphenyl)methyl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON(Cc2ccc(C=NN)cc2)C(=O)Cn2c(C)ccc(NS(=O)(=O)Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C30H31N5O7S2/c1-22-8-15-27(16-9-22)44(40,41)42-35(19-25-13-11-24(12-14-25)18-32-31)29(36)20-34-23(2)10-17-28(30(34)37)33-43(38,39)21-26-6-4-3-5-7-26/h3-18,33H,19-21,31H2,1-2H3 |
| InChIKey | HWZOKFQHMFTBMJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 170.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|