C32H33NO3 — CID 139938517
5-[5-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]-4-phenylpentanoic acid (PubChem CID 139938517) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is 5-[5-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]-4-phenylpentanoic acid.
| Compound Name | 5-[5-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]-4-phenylpentanoic acid |
|---|---|
| PubChem CID | 139938517 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 5-[5-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]naphthalen-1-yl]-4-phenylpentanoic acid |
| SMILES | Cc1ccccc1CCNC(=O)Cc1cccc2c(CC(CCC(=O)O)c3ccccc3)cccc12 |
| InChI | InChI=1S/C32H33NO3/c1-23-9-5-6-10-24(23)19-20-33-31(34)22-28-14-8-15-29-27(13-7-16-30(28)29)21-26(17-18-32(35)36)25-11-3-2-4-12-25/h2-16,26H,17-22H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | LFCZOKKGZAJIIG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |