C28H27ClFN3O5 — CID 139939725
4-[[2-[2-[3-chloro-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-2-fluoropyrrolidin-1-yl]methoxy]benzoic acid (PubChem CID 139939725) has the molecular formula C28H27ClFN3O5 and a molecular weight of 539.99 g/mol. Its IUPAC name is 4-[[2-[2-[3-chloro-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-2-fluoropyrrolidin-1-yl]methoxy]benzoic acid.
| Compound Name | 4-[[2-[2-[3-chloro-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-2-fluoropyrrolidin-1-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 139939725 |
| Molecular Formula | C28H27ClFN3O5 |
| Molecular Weight | 539.99 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-[[2-[2-[3-chloro-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]-2-fluoropyrrolidin-1-yl]methoxy]benzoic acid |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(CC(=O)C2(F)CCCN2COc2ccc(C(=O)O)cc2)cc1Cl |
| InChI | InChI=1S/C28H27ClFN3O5/c1-18-5-2-3-6-23(18)31-27(37)32-24-12-7-19(15-22(24)29)16-25(34)28(30)13-4-14-33(28)17-38-21-10-8-20(9-11-21)26(35)36/h2-3,5-12,15H,4,13-14,16-17H2,1H3,(H,35,36)(H2,31,32,37) |
| InChIKey | SDDOPMQSCUAYRP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|