C29H31N3O6 — CID 69333049
4-[2-[[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-methylidene-3-oxobutyl]amino]ethoxy]benzoic acid (PubChem CID 69333049) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is 4-[2-[[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-methylidene-3-oxobutyl]amino]ethoxy]benzoic acid.
| Compound Name | 4-[2-[[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-methylidene-3-oxobutyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 69333049 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 4-[2-[[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-methylidene-3-oxobutyl]amino]ethoxy]benzoic acid |
| SMILES | C=C(CNCCOc1ccc(C(=O)O)cc1)C(=O)Cc1ccc(NC(=O)Nc2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C29H31N3O6/c1-19-6-4-5-7-24(19)31-29(36)32-25-13-8-21(17-27(25)37-3)16-26(33)20(2)18-30-14-15-38-23-11-9-22(10-12-23)28(34)35/h4-13,17,30H,2,14-16,18H2,1,3H3,(H,34,35)(H2,31,32,36) |
| InChIKey | GKULRSSPIHLPLE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|