C27H30N4O6 — CID 69332175
3-amino-4-[2-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid (PubChem CID 69332175) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is 3-amino-4-[2-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid.
| Compound Name | 3-amino-4-[2-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 69332175 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 3-amino-4-[2-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid |
| SMILES | COc1cc(CC(=O)CNCCOc2ccc(C(=O)O)cc2N)ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H30N4O6/c1-17-5-3-4-6-22(17)30-27(35)31-23-9-7-18(14-25(23)36-2)13-20(32)16-29-11-12-37-24-10-8-19(26(33)34)15-21(24)28/h3-10,14-15,29H,11-13,16,28H2,1-2H3,(H,33,34)(H2,30,31,35) |
| InChIKey | KSEANYMZYMCAEZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|