C32H38N4O6 — CID 23512113
4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]-3-piperidin-1-ylbenzoic acid (PubChem CID 23512113) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is 4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]-3-piperidin-1-ylbenzoic acid.
| Compound Name | 4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]-3-piperidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 23512113 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]-3-piperidin-1-ylbenzoic acid |
| SMILES | COc1cc(CC(=O)CNC(C)Oc2ccc(C(=O)O)cc2N2CCCCC2)ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C32H38N4O6/c1-21-9-5-6-10-26(21)34-32(40)35-27-13-11-23(18-30(27)41-3)17-25(37)20-33-22(2)42-29-14-12-24(31(38)39)19-28(29)36-15-7-4-8-16-36/h5-6,9-14,18-19,22,33H,4,7-8,15-17,20H2,1-3H3,(H,38,39)(H2,34,35,40) |
| InChIKey | SFOCUJYBMBPZIG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|