C28H31N3O7 — CID 69333407
3-methoxy-4-[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-1-(methylamino)-3-oxobutoxy]benzoic acid (PubChem CID 69333407) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is 3-methoxy-4-[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-1-(methylamino)-3-oxobutoxy]benzoic acid.
| Compound Name | 3-methoxy-4-[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-1-(methylamino)-3-oxobutoxy]benzoic acid |
|---|---|
| PubChem CID | 69333407 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 3-methoxy-4-[4-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-1-(methylamino)-3-oxobutoxy]benzoic acid |
| SMILES | CNC(CC(=O)Cc1ccc(NC(=O)Nc2ccccc2C)c(OC)c1)Oc1ccc(C(=O)O)cc1OC |
| InChI | InChI=1S/C28H31N3O7/c1-17-7-5-6-8-21(17)30-28(35)31-22-11-9-18(14-24(22)36-3)13-20(32)16-26(29-2)38-23-12-10-19(27(33)34)15-25(23)37-4/h5-12,14-15,26,29H,13,16H2,1-4H3,(H,33,34)(H2,30,31,35) |
| InChIKey | HTFSRNTXLHEMNQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|