C27H28ClN3O6 — CID 23512394
3-chloro-4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid (PubChem CID 23512394) has the molecular formula C27H28ClN3O6 and a molecular weight of 525.99 g/mol. Its IUPAC name is 3-chloro-4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid.
| Compound Name | 3-chloro-4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 23512394 |
| Molecular Formula | C27H28ClN3O6 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 3-chloro-4-[1-[[3-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]-2-oxopropyl]amino]ethoxy]benzoic acid |
| SMILES | COc1cc(CC(=O)CNC(C)Oc2ccc(C(=O)O)cc2Cl)ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H28ClN3O6/c1-16-6-4-5-7-22(16)30-27(35)31-23-10-8-18(13-25(23)36-3)12-20(32)15-29-17(2)37-24-11-9-19(26(33)34)14-21(24)28/h4-11,13-14,17,29H,12,15H2,1-3H3,(H,33,34)(H2,30,31,35) |
| InChIKey | SAWWJHCKTCDYBI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|