C28H30FN3O7 — CID 69332393
4-[2-[[4-[4-[(2-fluorophenyl)carbamoylamino]-3-methoxyphenyl]-3-oxobutan-2-yl]amino]ethoxy]-3-methoxybenzoic acid (PubChem CID 69332393) has the molecular formula C28H30FN3O7 and a molecular weight of 539.56 g/mol. Its IUPAC name is 4-[2-[[4-[4-[(2-fluorophenyl)carbamoylamino]-3-methoxyphenyl]-3-oxobutan-2-yl]amino]ethoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[2-[[4-[4-[(2-fluorophenyl)carbamoylamino]-3-methoxyphenyl]-3-oxobutan-2-yl]amino]ethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 69332393 |
| Molecular Formula | C28H30FN3O7 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 4-[2-[[4-[4-[(2-fluorophenyl)carbamoylamino]-3-methoxyphenyl]-3-oxobutan-2-yl]amino]ethoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(CC(=O)C(C)NCCOc2ccc(C(=O)O)cc2OC)ccc1NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C28H30FN3O7/c1-17(30-12-13-39-24-11-9-19(27(34)35)16-26(24)38-3)23(33)14-18-8-10-22(25(15-18)37-2)32-28(36)31-21-7-5-4-6-20(21)29/h4-11,15-17,30H,12-14H2,1-3H3,(H,34,35)(H2,31,32,36) |
| InChIKey | ZHNSOCYNZFYJSA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|