C34H41N3O5 — CID 142036552
4-[2-[cyclopropyl-[2-[3-methoxy-4-[[(Z)-1-(2-methylanilino)hex-1-enyl]amino]phenyl]acetyl]amino]ethoxy]benzoic acid (PubChem CID 142036552) has the molecular formula C34H41N3O5 and a molecular weight of 571.72 g/mol. Its IUPAC name is 4-[2-[cyclopropyl-[2-[3-methoxy-4-[[(Z)-1-(2-methylanilino)hex-1-enyl]amino]phenyl]acetyl]amino]ethoxy]benzoic acid.
| Compound Name | 4-[2-[cyclopropyl-[2-[3-methoxy-4-[[(Z)-1-(2-methylanilino)hex-1-enyl]amino]phenyl]acetyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 142036552 |
| Molecular Formula | C34H41N3O5 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 4-[2-[cyclopropyl-[2-[3-methoxy-4-[[(Z)-1-(2-methylanilino)hex-1-enyl]amino]phenyl]acetyl]amino]ethoxy]benzoic acid |
| SMILES | CCCC/C=C(/Nc1ccccc1C)Nc1ccc(CC(=O)N(CCOc2ccc(C(=O)O)cc2)C2CC2)cc1OC |
| InChI | InChI=1S/C34H41N3O5/c1-4-5-6-11-32(35-29-10-8-7-9-24(29)2)36-30-19-12-25(22-31(30)41-3)23-33(38)37(27-15-16-27)20-21-42-28-17-13-26(14-18-28)34(39)40/h7-14,17-19,22,27,35-36H,4-6,15-16,20-21,23H2,1-3H3,(H,39,40)/b32-11- |
| InChIKey | GBJIFBHLSUVWGY-MDVINBTASA-N |
| XLogP | 6.87 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|