C29H31N3O4 — CID 142036435
4-[2-[[2-[4-[1-(2-methylanilino)ethenylamino]phenyl]acetyl]-prop-2-enylamino]ethoxy]benzoic acid (PubChem CID 142036435) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-[2-[[2-[4-[1-(2-methylanilino)ethenylamino]phenyl]acetyl]-prop-2-enylamino]ethoxy]benzoic acid.
| Compound Name | 4-[2-[[2-[4-[1-(2-methylanilino)ethenylamino]phenyl]acetyl]-prop-2-enylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 142036435 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 4-[2-[[2-[4-[1-(2-methylanilino)ethenylamino]phenyl]acetyl]-prop-2-enylamino]ethoxy]benzoic acid |
| SMILES | C=CCN(CCOc1ccc(C(=O)O)cc1)C(=O)Cc1ccc(NC(=C)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C29H31N3O4/c1-4-17-32(18-19-36-26-15-11-24(12-16-26)29(34)35)28(33)20-23-9-13-25(14-10-23)30-22(3)31-27-8-6-5-7-21(27)2/h4-16,30-31H,1,3,17-20H2,2H3,(H,34,35) |
| InChIKey | MKAMVZVZMABLOW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|