C29H32N4O6 — CID 10280127
4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]benzoic acid (PubChem CID 10280127) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10280127 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]benzoic acid |
| SMILES | COCCCN(CC(=O)Nc1ccc(C(=O)O)cc1)C(=O)Cc1ccc(NC(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C29H32N4O6/c1-20-6-3-4-7-25(20)32-29(38)31-24-12-8-21(9-13-24)18-27(35)33(16-5-17-39-2)19-26(34)30-23-14-10-22(11-15-23)28(36)37/h3-4,6-15H,5,16-19H2,1-2H3,(H,30,34)(H,36,37)(H2,31,32,38) |
| InChIKey | IALGCDAZRPYRNQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|