C32H38N4O6 — CID 163462228
(4S)-4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]-4-phenylbutanoic acid (PubChem CID 163462228) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is (4S)-4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]-4-phenylbutanoic acid.
| Compound Name | (4S)-4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 163462228 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (4S)-4-[[2-[3-methoxypropyl-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]acetyl]amino]-4-phenylbutanoic acid |
| SMILES | COCCCN(CC(=O)N[C@@H](CCC(=O)O)c1ccccc1)C(=O)Cc1ccc(NC(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C32H38N4O6/c1-23-9-6-7-12-27(23)35-32(41)33-26-15-13-24(14-16-26)21-30(38)36(19-8-20-42-2)22-29(37)34-28(17-18-31(39)40)25-10-4-3-5-11-25/h3-7,9-16,28H,8,17-22H2,1-2H3,(H,34,37)(H,39,40)(H2,33,35,41)/t28-/m0/s1 |
| InChIKey | BPOWLYSFPWFBGB-NDEPHWFRSA-N |
| XLogP | 4.77 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|