C27H29N3O6 — CID 58599326
4-[2-methoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid (PubChem CID 58599326) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is 4-[2-methoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-methoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 58599326 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 4-[2-methoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
| SMILES | COc1ccc(NC(=O)Cc2ccc(NC(=O)Nc3ccccc3C)cc2)cc1OCCCC(=O)O |
| InChI | InChI=1S/C27H29N3O6/c1-18-6-3-4-7-22(18)30-27(34)29-20-11-9-19(10-12-20)16-25(31)28-21-13-14-23(35-2)24(17-21)36-15-5-8-26(32)33/h3-4,6-7,9-14,17H,5,8,15-16H2,1-2H3,(H,28,31)(H,32,33)(H2,29,30,34) |
| InChIKey | MWGMXPJIDLKURW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|