C28H33N3O5 — CID 158565668
ethane;4-[4-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid (PubChem CID 158565668) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is ethane;4-[4-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid.
| Compound Name | ethane;4-[4-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 158565668 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | ethane;4-[4-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
| SMILES | CC.Cc1ccccc1NC(=O)Nc1ccc(CC(=O)Nc2ccc(OCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O5.C2H6/c1-18-5-2-3-6-23(18)29-26(33)28-21-10-8-19(9-11-21)17-24(30)27-20-12-14-22(15-13-20)34-16-4-7-25(31)32;1-2/h2-3,5-6,8-15H,4,7,16-17H2,1H3,(H,27,30)(H,31,32)(H2,28,29,33);1-2H3 |
| InChIKey | HRLCUDIWUCLPPO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|