C28H34N4O6 — CID 159320294
ethane;4-[2-methoxy-5-[[2-[4-[(3-methyl-2-pyridinyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid (PubChem CID 159320294) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is ethane;4-[2-methoxy-5-[[2-[4-[(3-methyl-2-pyridinyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid.
| Compound Name | ethane;4-[2-methoxy-5-[[2-[4-[(3-methyl-2-pyridinyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 159320294 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | ethane;4-[2-methoxy-5-[[2-[4-[(3-methyl-2-pyridinyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
| SMILES | CC.COc1ccc(NC(=O)Cc2ccc(NC(=O)Nc3ncccc3C)cc2)cc1OCCCC(=O)O |
| InChI | InChI=1S/C26H28N4O6.C2H6/c1-17-5-3-13-27-25(17)30-26(34)29-19-9-7-18(8-10-19)15-23(31)28-20-11-12-21(35-2)22(16-20)36-14-4-6-24(32)33;1-2/h3,5,7-13,16H,4,6,14-15H2,1-2H3,(H,28,31)(H,32,33)(H2,27,29,30,34);1-2H3 |
| InChIKey | LDRDWPBHMLBOHT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|