C29H35N3O5 — CID 158602731
ethane;5-[3-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]pentanoic acid (PubChem CID 158602731) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is ethane;5-[3-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]pentanoic acid.
| Compound Name | ethane;5-[3-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 158602731 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | ethane;5-[3-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]pentanoic acid |
| SMILES | CC.Cc1ccccc1NC(=O)Nc1ccc(CC(=O)Nc2cccc(OCCCCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H29N3O5.C2H6/c1-19-7-2-3-10-24(19)30-27(34)29-21-14-12-20(13-15-21)17-25(31)28-22-8-6-9-23(18-22)35-16-5-4-11-26(32)33;1-2/h2-3,6-10,12-15,18H,4-5,11,16-17H2,1H3,(H,28,31)(H,32,33)(H2,29,30,34);1-2H3 |
| InChIKey | HVVNYNFYTRVOHK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|