C28H31N3O6 — CID 20616422
4-[3-ethoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid (PubChem CID 20616422) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 4-[3-ethoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[3-ethoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 20616422 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[3-ethoxy-5-[[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]phenoxy]butanoic acid |
| SMILES | CCOc1cc(NC(=O)Cc2ccc(NC(=O)Nc3ccccc3C)cc2)cc(OCCCC(=O)O)c1 |
| InChI | InChI=1S/C28H31N3O6/c1-3-36-23-16-22(17-24(18-23)37-14-6-9-27(33)34)29-26(32)15-20-10-12-21(13-11-20)30-28(35)31-25-8-5-4-7-19(25)2/h4-5,7-8,10-13,16-18H,3,6,9,14-15H2,1-2H3,(H,29,32)(H,33,34)(H2,30,31,35) |
| InChIKey | AHRPPVFTMLQTKA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|