C27H25N3O8 — CID 139940375
2-[[2-[[(2S)-2-[bis[3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid (PubChem CID 139940375) has the molecular formula C27H25N3O8 and a molecular weight of 519.51 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-[bis[3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(2S)-2-[bis[3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 139940375 |
| Molecular Formula | C27H25N3O8 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-[[2-[[(2S)-2-[bis[3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)[C@H](Cc1ccccc1)N(C(=O)C=Cc1ccco1)C(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C27H25N3O8/c31-23(28-18-26(34)35)17-29-27(36)22(16-19-6-2-1-3-7-19)30(24(32)12-10-20-8-4-14-37-20)25(33)13-11-21-9-5-15-38-21/h1-15,22H,16-18H2,(H,28,31)(H,29,36)(H,34,35)/t22-/m0/s1 |
| InChIKey | RLNCHMKBHLVPRH-QFIPXVFZSA-N |
| XLogP | 1.88 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|