C25H29F3N4O3 — CID 139942286
N-[3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]-N-[4-(1-methylpiperidin-4-yl)oxy-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 139942286) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is N-[3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]-N-[4-(1-methylpiperidin-4-yl)oxy-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]-N-[4-(1-methylpiperidin-4-yl)oxy-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 139942286 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[3-(5-carbamimidoyl-2-hydroxyphenyl)prop-2-enyl]-N-[4-(1-methylpiperidin-4-yl)oxy-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(C=CCN(C(C)=O)c2ccc(OC3CCN(C)CC3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H29F3N4O3/c1-16(33)32(11-3-4-17-14-18(24(29)30)5-7-22(17)34)19-6-8-23(21(15-19)25(26,27)28)35-20-9-12-31(2)13-10-20/h3-8,14-15,20,34H,9-13H2,1-2H3,(H3,29,30) |
| InChIKey | ODFZYEYBPJUHRJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|