C32H40F3N5O7 — CID 135484154
ethyl 4-[4-(1-acetylpiperidin-4-yl)oxy-N-[4-(5-carbamimidoyl-2-hydroxyanilino)-2-methyl-4-oxobutyl]-3-(trifluoromethyl)anilino]-4-oxobutanoate (PubChem CID 135484154) has the molecular formula C32H40F3N5O7 and a molecular weight of 663.69 g/mol. Its IUPAC name is ethyl 4-[4-(1-acetylpiperidin-4-yl)oxy-N-[4-(5-carbamimidoyl-2-hydroxyanilino)-2-methyl-4-oxobutyl]-3-(trifluoromethyl)anilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(1-acetylpiperidin-4-yl)oxy-N-[4-(5-carbamimidoyl-2-hydroxyanilino)-2-methyl-4-oxobutyl]-3-(trifluoromethyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 135484154 |
| Molecular Formula | C32H40F3N5O7 |
| Molecular Weight | 663.69 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | ethyl 4-[4-(1-acetylpiperidin-4-yl)oxy-N-[4-(5-carbamimidoyl-2-hydroxyanilino)-2-methyl-4-oxobutyl]-3-(trifluoromethyl)anilino]-4-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc(O)c(NC(=O)CC(C)CN(C(=O)CCC(=O)OCC)c2ccc(OC3CCN(C(C)=O)CC3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C32H40F3N5O7/c1-4-46-30(45)10-9-29(44)40(18-19(2)15-28(43)38-25-16-21(31(36)37)5-7-26(25)42)22-6-8-27(24(17-22)32(33,34)35)47-23-11-13-39(14-12-23)20(3)41/h5-8,16-17,19,23,42H,4,9-15,18H2,1-3H3,(H3,36,37)(H,38,43) |
| InChIKey | LJUDOJFAZAQAHC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 175.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|