C31H28F3N5OS — CID 139942686
3-(4-acetylphenyl)-1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 139942686) has the molecular formula C31H28F3N5OS and a molecular weight of 575.66 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 3-(4-acetylphenyl)-1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 139942686 |
| Molecular Formula | C31H28F3N5OS |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 3-(4-acetylphenyl)-1-[3-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]propyl]-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)N(CCCc2cncn2Cc2ccc(C#N)cc2)Cc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H28F3N5OS/c1-22(40)25-12-14-27(15-13-25)37-30(41)38(20-26-5-2-3-7-29(26)31(32,33)34)16-4-6-28-18-36-21-39(28)19-24-10-8-23(17-35)9-11-24/h2-3,5,7-15,18,21H,4,6,16,19-20H2,1H3,(H,37,41) |
| InChIKey | XTRXUPAEAPGJQN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|