C36H45F3N4O4 — CID 139949224
N-[1-[4-[2,6-diethoxy-N-(ethylcarbamoyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139949224) has the molecular formula C36H45F3N4O4 and a molecular weight of 654.77 g/mol. Its IUPAC name is N-[1-[4-[2,6-diethoxy-N-(ethylcarbamoyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[1-[4-[2,6-diethoxy-N-(ethylcarbamoyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139949224 |
| Molecular Formula | C36H45F3N4O4 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | N-[1-[4-[2,6-diethoxy-N-(ethylcarbamoyl)anilino]butyl]piperidin-4-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCNC(=O)N(CCCCN1CCC(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1)c1c(OCC)cccc1OCC |
| InChI | InChI=1S/C36H45F3N4O4/c1-4-40-35(45)43(33-31(46-5-2)14-11-15-32(33)47-6-3)23-10-9-22-42-24-20-28(21-25-42)41-34(44)30-13-8-7-12-29(30)26-16-18-27(19-17-26)36(37,38)39/h7-8,11-19,28H,4-6,9-10,20-25H2,1-3H3,(H,40,45)(H,41,44) |
| InChIKey | NRQWBRNIKSCPDL-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|