C13H11F3O2 — CID 139952197
(5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) propanoate (PubChem CID 139952197) has the molecular formula C13H11F3O2 and a molecular weight of 256.22 g/mol. Its IUPAC name is (5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) propanoate.
| Compound Name | (5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) propanoate |
|---|---|
| PubChem CID | 139952197 |
| Molecular Formula | C13H11F3O2 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) propanoate |
| SMILES | CCC(=O)OC1=Cc2cc(F)c(F)c(F)c2CC1 |
| InChI | InChI=1S/C13H11F3O2/c1-2-11(17)18-8-3-4-9-7(5-8)6-10(14)13(16)12(9)15/h5-6H,2-4H2,1H3 |
| InChIKey | FWIPKOFQXWVIBK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|