C31H38O3 — CID 139952304
2-ethyl-4-[1-(3-ethyl-4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]cyclohexyl]phenol (PubChem CID 139952304) has the molecular formula C31H38O3 and a molecular weight of 458.64 g/mol. Its IUPAC name is 2-ethyl-4-[1-(3-ethyl-4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]cyclohexyl]phenol.
| Compound Name | 2-ethyl-4-[1-(3-ethyl-4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]cyclohexyl]phenol |
|---|---|
| PubChem CID | 139952304 |
| Molecular Formula | C31H38O3 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 2-ethyl-4-[1-(3-ethyl-4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]cyclohexyl]phenol |
| SMILES | CCc1cc(C2(c3ccc(O)c(CC)c3)CCC(C(C)(C)c3ccc(O)cc3)CC2)ccc1O |
| InChI | InChI=1S/C31H38O3/c1-5-21-19-25(9-13-28(21)33)31(26-10-14-29(34)22(6-2)20-26)17-15-24(16-18-31)30(3,4)23-7-11-27(32)12-8-23/h7-14,19-20,24,32-34H,5-6,15-18H2,1-4H3 |
| InChIKey | JPSACDRGGMNFAQ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |