C21H26O3 — CID 139833129
4-[1-(4-hydroxyphenyl)-4-propylcyclohexyl]benzene-1,2-diol (PubChem CID 139833129) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-4-propylcyclohexyl]benzene-1,2-diol.
| Compound Name | 4-[1-(4-hydroxyphenyl)-4-propylcyclohexyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 139833129 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-4-propylcyclohexyl]benzene-1,2-diol |
| SMILES | CCCC1CCC(c2ccc(O)cc2)(c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C21H26O3/c1-2-3-15-10-12-21(13-11-15,16-4-7-18(22)8-5-16)17-6-9-19(23)20(24)14-17/h4-9,14-15,22-24H,2-3,10-13H2,1H3 |
| InChIKey | ANHGGLDTWGKENX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|