C19H20F2O — CID 149126952
4-[1-(3,4-difluorophenyl)-4-methylcyclohexyl]phenol (PubChem CID 149126952) has the molecular formula C19H20F2O and a molecular weight of 302.36 g/mol. Its IUPAC name is 4-[1-(3,4-difluorophenyl)-4-methylcyclohexyl]phenol.
| Compound Name | 4-[1-(3,4-difluorophenyl)-4-methylcyclohexyl]phenol |
|---|---|
| PubChem CID | 149126952 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[1-(3,4-difluorophenyl)-4-methylcyclohexyl]phenol |
| SMILES | CC1CCC(c2ccc(O)cc2)(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H20F2O/c1-13-8-10-19(11-9-13,14-2-5-16(22)6-3-14)15-4-7-17(20)18(21)12-15/h2-7,12-13,22H,8-11H2,1H3 |
| InChIKey | RBBWMVUFHTYYDV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |