C21H29F — CID 139960593
8-fluoro-3-(4-pentylcyclohexyl)-1,2-dihydronaphthalene (PubChem CID 139960593) has the molecular formula C21H29F and a molecular weight of 300.46 g/mol. Its IUPAC name is 8-fluoro-3-(4-pentylcyclohexyl)-1,2-dihydronaphthalene.
| Compound Name | 8-fluoro-3-(4-pentylcyclohexyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139960593 |
| Molecular Formula | C21H29F |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 8-fluoro-3-(4-pentylcyclohexyl)-1,2-dihydronaphthalene |
| SMILES | CCCCCC1CCC(C2=Cc3cccc(F)c3CC2)CC1 |
| InChI | InChI=1S/C21H29F/c1-2-3-4-6-16-9-11-17(12-10-16)18-13-14-20-19(15-18)7-5-8-21(20)22/h5,7-8,15-17H,2-4,6,9-14H2,1H3 |
| InChIKey | VYGGTLKAHVUEJA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|