C27H30F4 — CID 139952238
6,7,8-trifluoro-3-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene (PubChem CID 139952238) has the molecular formula C27H30F4 and a molecular weight of 430.53 g/mol. Its IUPAC name is 6,7,8-trifluoro-3-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene.
| Compound Name | 6,7,8-trifluoro-3-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139952238 |
| Molecular Formula | C27H30F4 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 6,7,8-trifluoro-3-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene |
| SMILES | CCCCCC1CCC(c2ccc(C3=Cc4cc(F)c(F)c(F)c4CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H30F4/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-22(24(28)15-19)20-11-13-23-21(14-20)16-25(29)27(31)26(23)30/h10,12,14-18H,2-9,11,13H2,1H3 |
| InChIKey | BFLRQDZPVRESMW-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|