C25H24F3N — CID 139951958
6-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-7,8-dihydronaphthalene-2-carbonitrile (PubChem CID 139951958) has the molecular formula C25H24F3N and a molecular weight of 395.47 g/mol. Its IUPAC name is 6-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-7,8-dihydronaphthalene-2-carbonitrile.
| Compound Name | 6-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-7,8-dihydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139951958 |
| Molecular Formula | C25H24F3N |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 6-[4-(4-ethylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-7,8-dihydronaphthalene-2-carbonitrile |
| SMILES | CCC1CCC(c2ccc(C3=Cc4cc(F)c(C#N)c(F)c4CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H24F3N/c1-2-15-3-5-16(6-4-15)17-7-9-20(23(26)12-17)18-8-10-21-19(11-18)13-24(27)22(14-29)25(21)28/h7,9,11-13,15-16H,2-6,8,10H2,1H3 |
| InChIKey | LHNXIMFSODFGKM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|