C28H31F3O2 — CID 139951924
(5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) 4-(4-pentylcyclohexyl)benzoate (PubChem CID 139951924) has the molecular formula C28H31F3O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) 4-(4-pentylcyclohexyl)benzoate.
| Compound Name | (5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) 4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 139951924 |
| Molecular Formula | C28H31F3O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (5,6,7-trifluoro-3,4-dihydronaphthalen-2-yl) 4-(4-pentylcyclohexyl)benzoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)OC3=Cc4cc(F)c(F)c(F)c4CC3)cc2)CC1 |
| InChI | InChI=1S/C28H31F3O2/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)28(32)33-23-14-15-24-22(16-23)17-25(29)27(31)26(24)30/h10-13,16-19H,2-9,14-15H2,1H3 |
| InChIKey | DBPVUHSRIAXLEI-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|