About benzyl bis(tetramethyl-λ5-phosphanyl) borate
benzyl bis(tetramethyl-λ5-phosphanyl) borate (PubChem CID 139962615) has the molecular formula C15H31BO3P2
and a molecular weight of 332.17 g/mol. Its IUPAC name is benzyl bis(tetramethyl-λ5-phosphanyl) borate.
Molecular Properties
| Compound Name | benzyl bis(tetramethyl-λ5-phosphanyl) borate |
| PubChem CID | 139962615 |
| Molecular Formula | C15H31BO3P2 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | benzyl bis(tetramethyl-λ5-phosphanyl) borate |
| SMILES | CP(C)(C)(C)OB(OCc1ccccc1)OP(C)(C)(C)C |
| InChI | InChI=1S/C15H31BO3P2/c1-20(2,3,4)18-16(19-21(5,6,7)8)17-14-15-12-10-9-11-13-15/h9-13H,14H2,1-8H3 |
| InChIKey | OJSWBFQOHIDZGK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl bis(tetramethyl-λ5-phosphanyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl bis(tetramethyl-λ5-phosphanyl) borate?
The IUPAC name of benzyl bis(tetramethyl-λ5-phosphanyl) borate (CID 139962615) is benzyl bis(tetramethyl-λ5-phosphanyl) borate.
What is the SMILES notation for benzyl bis(tetramethyl-λ5-phosphanyl) borate?
The canonical SMILES for benzyl bis(tetramethyl-λ5-phosphanyl) borate is CP(C)(C)(C)OB(OCc1ccccc1)OP(C)(C)(C)C.
What is the InChIKey of benzyl bis(tetramethyl-λ5-phosphanyl) borate?
The InChIKey is OJSWBFQOHIDZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31BO3P2/c1-20(2,3,4)18-16(19-21(5,6,7)8)17-14-15-12-10-9-11-13-15/h9-13H,14H2,1-8H3.
What are the key properties of benzyl bis(tetramethyl-λ5-phosphanyl) borate?
benzyl bis(tetramethyl-λ5-phosphanyl) borate has a molecular weight of 332.17 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl bis(tetramethyl-λ5-phosphanyl) borate is sourced from PubChem (CID 139962615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).