About 4-methyl-3-oxotridecanal
4-methyl-3-oxotridecanal (PubChem CID 139962619) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-methyl-3-oxotridecanal.
Molecular Properties
| Compound Name | 4-methyl-3-oxotridecanal |
| PubChem CID | 139962619 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 4-methyl-3-oxotridecanal |
| SMILES | CCCCCCCCCC(C)C(=O)CC=O |
| InChI | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-13(2)14(16)11-12-15/h12-13H,3-11H2,1-2H3 |
| InChIKey | GHNYVEJYTISSAH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-oxotridecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-oxotridecanal?
The IUPAC name of 4-methyl-3-oxotridecanal (CID 139962619) is 4-methyl-3-oxotridecanal.
What is the SMILES notation for 4-methyl-3-oxotridecanal?
The canonical SMILES for 4-methyl-3-oxotridecanal is CCCCCCCCCC(C)C(=O)CC=O.
What is the InChIKey of 4-methyl-3-oxotridecanal?
The InChIKey is GHNYVEJYTISSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-13(2)14(16)11-12-15/h12-13H,3-11H2,1-2H3.
What are the key properties of 4-methyl-3-oxotridecanal?
4-methyl-3-oxotridecanal has a molecular weight of 226.36 g/mol, XLogP of 3.92, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-oxotridecanal is sourced from PubChem (CID 139962619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).