C31H32F3N5O2 — CID 139962655
2,2,2-trifluoroethyl 9-[4-[4-(3-methylimidazo[4,5-b]pyridin-2-yl)piperazin-1-yl]butyl]fluorene-9-carboxylate (PubChem CID 139962655) has the molecular formula C31H32F3N5O2 and a molecular weight of 563.62 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 9-[4-[4-(3-methylimidazo[4,5-b]pyridin-2-yl)piperazin-1-yl]butyl]fluorene-9-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 9-[4-[4-(3-methylimidazo[4,5-b]pyridin-2-yl)piperazin-1-yl]butyl]fluorene-9-carboxylate |
|---|---|
| PubChem CID | 139962655 |
| Molecular Formula | C31H32F3N5O2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 2,2,2-trifluoroethyl 9-[4-[4-(3-methylimidazo[4,5-b]pyridin-2-yl)piperazin-1-yl]butyl]fluorene-9-carboxylate |
| SMILES | Cn1c(N2CCN(CCCCC3(C(=O)OCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)nc2cccnc21 |
| InChI | InChI=1S/C31H32F3N5O2/c1-37-27-26(13-8-15-35-27)36-29(37)39-19-17-38(18-20-39)16-7-6-14-30(28(40)41-21-31(32,33)34)24-11-4-2-9-22(24)23-10-3-5-12-25(23)30/h2-5,8-13,15H,6-7,14,16-21H2,1H3 |
| InChIKey | UYNYEXJICXOMLD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|